C37H39N5O7S — CID 23919448
(4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23919448) has the molecular formula C37H39N5O7S and a molecular weight of 697.81 g/mol. Its IUPAC name is (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23919448 |
| Molecular Formula | C37H39N5O7S |
| Molecular Weight | 697.81 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc(CCNC(=O)[C@]2(CCS(=O)(=O)c3ccccc3)N=C(c3ccc(OCCCO)cc3)O[C@@H]2c2ccccc2CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C37H39N5O7S/c1-47-31-11-7-9-27(25-31)19-21-39-36(44)37(20-24-50(45,46)32-12-3-2-4-13-32)34(33-14-6-5-10-29(33)26-40-42-38)49-35(41-37)28-15-17-30(18-16-28)48-23-8-22-43/h2-7,9-18,25,34,43H,8,19-24,26H2,1H3,(H,39,44)/t34-,37-/m1/s1 |
| InChIKey | DGYCNNBAWZGUFH-ZLHGTEGGSA-N |
| XLogP | 5.75 |
| TPSA | 172.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.81 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|