C36H38BrN3O7S — CID 23864068
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23864068) has the molecular formula C36H38BrN3O7S and a molecular weight of 736.68 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23864068 |
| Molecular Formula | C36H38BrN3O7S |
| Molecular Weight | 736.68 g/mol |
| Exact Mass | 735.16 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[2-(3-methoxyphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc(CCNNC(=O)[C@@]2(CCS(=O)(=O)c3ccccc3)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C36H38BrN3O7S/c1-45-31-8-5-7-26(25-31)19-21-38-40-35(42)36(20-24-48(43,44)32-9-3-2-4-10-32)33(27-11-15-29(37)16-12-27)47-34(39-36)28-13-17-30(18-14-28)46-23-6-22-41/h2-5,7-18,25,33,38,41H,6,19-24H2,1H3,(H,40,42)/t33-,36-/m0/s1 |
| InChIKey | WGCMPCXBDGGYIA-JUKUECOXSA-N |
| XLogP | 5.20 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.68 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|