C37H41N3O7S — CID 23777368
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23777368) has the molecular formula C37H41N3O7S and a molecular weight of 671.82 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23777368 |
| Molecular Formula | C37H41N3O7S |
| Molecular Weight | 671.82 g/mol |
| Exact Mass | 671.27 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-[2-(4-methylphenyl)ethyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(CCS(=O)(=O)c2ccccc2)C(=O)NNCCc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C37H41N3O7S/c1-27-12-14-28(15-13-27)20-22-38-40-36(42)37(21-25-48(43,44)33-10-4-3-5-11-33)34(30-8-6-9-32(26-30)45-2)47-35(39-37)29-16-18-31(19-17-29)46-24-7-23-41/h3-6,8-19,26,34,38,41H,7,20-25H2,1-2H3,(H,40,42)/t34-,37-/m0/s1 |
| InChIKey | UCRDJLUGOGNJRP-UNVMMQEESA-N |
| XLogP | 4.75 |
| TPSA | 135.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.82 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|