C28H31N3O5 — CID 23975321
(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-methyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975321) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-methyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-methyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975321 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | (4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-methyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CNNC(=O)[C@@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C28H31N3O5/c1-29-31-27(33)28(19-20-8-4-3-5-9-20)25(22-10-6-11-24(18-22)34-2)36-26(30-28)21-12-14-23(15-13-21)35-17-7-16-32/h3-6,8-15,18,25,29,32H,7,16-17,19H2,1-2H3,(H,31,33)/t25-,28-/m0/s1 |
| InChIKey | FMVOOYSLJMJLEA-LSYYVWMOSA-N |
| XLogP | 3.21 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|