C36H40N4O5 — CID 23947240
(4S,5S)-4-benzyl-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947240) has the molecular formula C36H40N4O5 and a molecular weight of 608.74 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-benzyl-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947240 |
| Molecular Formula | C36H40N4O5 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.30 |
| IUPAC Name | (4S,5S)-4-benzyl-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(Cc2ccccc2)C(=O)NNCc2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C36H40N4O5/c1-40(2)30-17-13-27(14-18-30)25-37-39-35(42)36(24-26-9-5-4-6-10-26)33(29-11-7-12-32(23-29)43-3)45-34(38-36)28-15-19-31(20-16-28)44-22-8-21-41/h4-7,9-20,23,33,37,41H,8,21-22,24-25H2,1-3H3,(H,39,42)/t33-,36-/m0/s1 |
| InChIKey | ZWOVNSSBOHWMAQ-JUKUECOXSA-N |
| XLogP | 4.84 |
| TPSA | 104.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|