C36H38FN3O5S — CID 23947220
(4S,5S)-4-benzyl-N'-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947220) has the molecular formula C36H38FN3O5S and a molecular weight of 643.78 g/mol. Its IUPAC name is (4S,5S)-4-benzyl-N'-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-benzyl-N'-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947220 |
| Molecular Formula | C36H38FN3O5S |
| Molecular Weight | 643.78 g/mol |
| Exact Mass | 643.25 |
| IUPAC Name | (4S,5S)-4-benzyl-N'-[2-[(4-fluorophenyl)methylsulfanyl]ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(Cc2ccccc2)C(=O)NNCCSCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C36H38FN3O5S/c1-43-32-10-5-9-29(23-32)33-36(24-26-7-3-2-4-8-26,35(42)40-38-19-22-46-25-27-11-15-30(37)16-12-27)39-34(45-33)28-13-17-31(18-14-28)44-21-6-20-41/h2-5,7-18,23,33,38,41H,6,19-22,24-25H2,1H3,(H,40,42)/t33-,36-/m0/s1 |
| InChIKey | FZFRQBYYFOIEAQ-JUKUECOXSA-N |
| XLogP | 5.65 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.78 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|