C28H30N2O5 — CID 23920271
(4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-methyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23920271) has the molecular formula C28H30N2O5 and a molecular weight of 474.56 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-methyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-methyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23920271 |
| Molecular Formula | C28H30N2O5 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-methyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | CNC(=O)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C28H30N2O5/c1-29-27(32)28(19-20-8-4-3-5-9-20)25(22-10-6-11-24(18-22)33-2)35-26(30-28)21-12-14-23(15-13-21)34-17-7-16-31/h3-6,8-15,18,25,31H,7,16-17,19H2,1-2H3,(H,29,32)/t25-,28-/m1/s1 |
| InChIKey | PBEOINHANXZLPZ-LEAFIULHSA-N |
| XLogP | 3.70 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|