C33H38N2O6 — CID 23864421
(4R,5R)-4-benzyl-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23864421) has the molecular formula C33H38N2O6 and a molecular weight of 558.67 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23864421 |
| Molecular Formula | C33H38N2O6 |
| Molecular Weight | 558.67 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | (4R,5R)-4-benzyl-N-(4-hydroxycyclohexyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(Cc2ccccc2)C(=O)NC2CCC(O)CC2)c1 |
| InChI | InChI=1S/C33H38N2O6/c1-39-29-10-5-9-25(21-29)30-33(22-23-7-3-2-4-8-23,32(38)34-26-13-15-27(37)16-14-26)35-31(41-30)24-11-17-28(18-12-24)40-20-6-19-36/h2-5,7-12,17-18,21,26-27,30,36-37H,6,13-16,19-20,22H2,1H3,(H,34,38)/t26?,27?,30-,33-/m1/s1 |
| InChIKey | RJNJRXRVEIWJIC-TWARTSCXSA-N |
| XLogP | 4.38 |
| TPSA | 109.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.67 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|