C32H34N2O5 — CID 23947477
(4R,5R)-N-(2,3-dihydro-1H-inden-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23947477) has the molecular formula C32H34N2O5 and a molecular weight of 526.63 g/mol. Its IUPAC name is (4R,5R)-N-(2,3-dihydro-1H-inden-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-N-(2,3-dihydro-1H-inden-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23947477 |
| Molecular Formula | C32H34N2O5 |
| Molecular Weight | 526.63 g/mol |
| Exact Mass | 526.25 |
| IUPAC Name | (4R,5R)-N-(2,3-dihydro-1H-inden-2-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C=CC[C@@]1(C(=O)NC2Cc3ccccc3C2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C32H34N2O5/c1-3-16-32(31(36)33-26-19-23-8-4-5-9-24(23)20-26)29(25-10-6-11-28(21-25)37-2)39-30(34-32)22-12-14-27(15-13-22)38-18-7-17-35/h3-6,8-15,21,26,29,35H,1,7,16-20H2,2H3,(H,33,36)/t29-,32-/m1/s1 |
| InChIKey | MTVDKNYXBCBJGW-QLWXXVCSSA-N |
| XLogP | 4.57 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|