C31H33BrN2O5 — CID 23835310
(4R,5R)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23835310) has the molecular formula C31H33BrN2O5 and a molecular weight of 593.52 g/mol. Its IUPAC name is (4R,5R)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23835310 |
| Molecular Formula | C31H33BrN2O5 |
| Molecular Weight | 593.52 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | (4R,5R)-5-(4-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[2-(3-methoxyphenyl)ethyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C=CC[C@@]1(C(=O)NCCc2cccc(OC)c2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H33BrN2O5/c1-3-17-31(30(36)33-18-16-22-6-4-7-27(21-22)37-2)28(23-8-12-25(32)13-9-23)39-29(34-31)24-10-14-26(15-11-24)38-20-5-19-35/h3-4,6-15,21,28,35H,1,5,16-20H2,2H3,(H,33,36)/t28-,31-/m1/s1 |
| InChIKey | BISYUIVFFAYQBB-GRKNLSHJSA-N |
| XLogP | 5.41 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.52 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|