C30H31Cl2N3O5 — CID 23863443
(4S,5S)-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23863443) has the molecular formula C30H31Cl2N3O5 and a molecular weight of 584.50 g/mol. Its IUPAC name is (4S,5S)-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23863443 |
| Molecular Formula | C30H31Cl2N3O5 |
| Molecular Weight | 584.50 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | (4S,5S)-N'-[(3,4-dichlorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C=CC[C@]1(C(=O)NNCc2ccc(Cl)c(Cl)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C30H31Cl2N3O5/c1-3-14-30(29(37)35-33-19-20-8-13-25(31)26(32)17-20)27(22-6-4-7-24(18-22)38-2)40-28(34-30)21-9-11-23(12-10-21)39-16-5-15-36/h3-4,6-13,17-18,27,33,36H,1,5,14-16,19H2,2H3,(H,35,37)/t27-,30-/m0/s1 |
| InChIKey | XOJLGYSHGYOVAM-FIBWVYCGSA-N |
| XLogP | 5.42 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.50 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|