C31H27Cl2F6N3O4 — CID 23835782
(4S,5S)-N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23835782) has the molecular formula C31H27Cl2F6N3O4 and a molecular weight of 690.47 g/mol. Its IUPAC name is (4S,5S)-N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23835782 |
| Molecular Formula | C31H27Cl2F6N3O4 |
| Molecular Weight | 690.47 g/mol |
| Exact Mass | 689.13 |
| IUPAC Name | (4S,5S)-N'-[[3,5-bis(trifluoromethyl)phenyl]methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C=CC[C@]1(C(=O)NNCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H27Cl2F6N3O4/c1-2-10-29(28(44)42-40-17-18-13-20(30(34,35)36)15-21(14-18)31(37,38)39)26(24-9-6-22(32)16-25(24)33)46-27(41-29)19-4-7-23(8-5-19)45-12-3-11-43/h2,4-9,13-16,26,40,43H,1,3,10-12,17H2,(H,42,44)/t26-,29-/m0/s1 |
| InChIKey | BMCPESKJLVBSKV-WNJJXGMVSA-N |
| XLogP | 7.45 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.47 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|