C25H27F4N3O4 — CID 23748807
(4S,5S)-N'-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23748807) has the molecular formula C25H27F4N3O4 and a molecular weight of 509.50 g/mol. Its IUPAC name is (4S,5S)-N'-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23748807 |
| Molecular Formula | C25H27F4N3O4 |
| Molecular Weight | 509.50 g/mol |
| Exact Mass | 509.19 |
| IUPAC Name | (4S,5S)-N'-[[3-fluoro-5-(trifluoromethyl)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C=CC[C@]1(C(=O)NNCc2cc(F)cc(C(F)(F)F)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1C |
| InChI | InChI=1S/C25H27F4N3O4/c1-3-9-24(23(34)32-30-15-17-12-19(25(27,28)29)14-20(26)13-17)16(2)36-22(31-24)18-5-7-21(8-6-18)35-11-4-10-33/h3,5-8,12-14,16,30,33H,1,4,9-11,15H2,2H3,(H,32,34)/t16-,24-/m0/s1 |
| InChIKey | AIFIXCMJBOMBHT-FYSMJZIKSA-N |
| XLogP | 3.91 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.50 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|