C31H32F3N3O4 — CID 23863911
(4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23863911) has the molecular formula C31H32F3N3O4 and a molecular weight of 567.61 g/mol. Its IUPAC name is (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23863911 |
| Molecular Formula | C31H32F3N3O4 |
| Molecular Weight | 567.61 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-N'-[[3-(trifluoromethyl)phenyl]methyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(C/C=C/c1ccccc1)C(=O)NNCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C31H32F3N3O4/c1-22-30(17-6-11-23-8-3-2-4-9-23,29(39)37-35-21-24-10-5-12-26(20-24)31(32,33)34)36-28(41-22)25-13-15-27(16-14-25)40-19-7-18-38/h2-6,8-16,20,22,35,38H,7,17-19,21H2,1H3,(H,37,39)/b11-6+/t22-,30-/m0/s1 |
| InChIKey | AVOYGUXUZRSBRZ-ODQGLTFSSA-N |
| XLogP | 5.30 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.61 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|