C42H41N3O5 — CID 23947257
(4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(4-methoxyphenyl)methyl]-5-(4-phenylphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23947257) has the molecular formula C42H41N3O5 and a molecular weight of 667.81 g/mol. Its IUPAC name is (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(4-methoxyphenyl)methyl]-5-(4-phenylphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(4-methoxyphenyl)methyl]-5-(4-phenylphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23947257 |
| Molecular Formula | C42H41N3O5 |
| Molecular Weight | 667.81 g/mol |
| Exact Mass | 667.30 |
| IUPAC Name | (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(4-methoxyphenyl)methyl]-5-(4-phenylphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1ccc(CNNC(=O)[C@@]2(C/C=C/c3ccccc3)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccc(-c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C42H41N3O5/c1-48-37-23-15-32(16-24-37)30-43-45-41(47)42(27-8-12-31-10-4-2-5-11-31)39(35-19-17-34(18-20-35)33-13-6-3-7-14-33)50-40(44-42)36-21-25-38(26-22-36)49-29-9-28-46/h2-8,10-26,39,43,46H,9,27-30H2,1H3,(H,45,47)/b12-8+/t39-,42-/m0/s1 |
| InChIKey | SZBAZLKTMCXXKB-FBQZRSIPSA-N |
| XLogP | 7.30 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.81 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|