C33H39N3O7 — CID 23891912
(4S,5S)-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23891912) has the molecular formula C33H39N3O7 and a molecular weight of 589.69 g/mol. Its IUPAC name is (4S,5S)-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23891912 |
| Molecular Formula | C33H39N3O7 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | (4S,5S)-N'-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(C/C=C/c2ccccc2)C(=O)NNCC(OC)OC)c1 |
| InChI | InChI=1S/C33H39N3O7/c1-39-28-14-7-13-26(22-28)30-33(19-8-12-24-10-5-4-6-11-24,32(38)36-34-23-29(40-2)41-3)35-31(43-30)25-15-17-27(18-16-25)42-21-9-20-37/h4-8,10-18,22,29-30,34,37H,9,19-21,23H2,1-3H3,(H,36,38)/b12-8+/t30-,33-/m0/s1 |
| InChIKey | BLIUMFQGTBKXLZ-CUMPVIFMSA-N |
| XLogP | 4.06 |
| TPSA | 119.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|