C32H35BrN2O6 — CID 23975498
(4R,5R)-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23975498) has the molecular formula C32H35BrN2O6 and a molecular weight of 623.54 g/mol. Its IUPAC name is (4R,5R)-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23975498 |
| Molecular Formula | C32H35BrN2O6 |
| Molecular Weight | 623.54 g/mol |
| Exact Mass | 622.17 |
| IUPAC Name | (4R,5R)-5-(4-bromophenyl)-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COC(CNC(=O)[C@]1(C/C=C/c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Br)cc1)OC |
| InChI | InChI=1S/C32H35BrN2O6/c1-38-28(39-2)22-34-31(37)32(19-6-10-23-8-4-3-5-9-23)29(24-11-15-26(33)16-12-24)41-30(35-32)25-13-17-27(18-14-25)40-21-7-20-36/h3-6,8-18,28-29,36H,7,19-22H2,1-2H3,(H,34,37)/b10-6+/t29-,32-/m1/s1 |
| InChIKey | ILHNEYWQGSIFAU-QSSNUHTJSA-N |
| XLogP | 5.31 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|