C31H36N2O7 — CID 23976218
(4R,5R)-4-benzyl-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23976218) has the molecular formula C31H36N2O7 and a molecular weight of 548.64 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23976218 |
| Molecular Formula | C31H36N2O7 |
| Molecular Weight | 548.64 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | (4R,5R)-4-benzyl-N-(2,2-dimethoxyethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(Cc2ccccc2)C(=O)NCC(OC)OC)c1 |
| InChI | InChI=1S/C31H36N2O7/c1-36-26-12-7-11-24(19-26)28-31(20-22-9-5-4-6-10-22,30(35)32-21-27(37-2)38-3)33-29(40-28)23-13-15-25(16-14-23)39-18-8-17-34/h4-7,9-16,19,27-28,34H,8,17-18,20-21H2,1-3H3,(H,32,35)/t28-,31-/m1/s1 |
| InChIKey | LLWUAYOLZPRGKY-GRKNLSHJSA-N |
| XLogP | 3.69 |
| TPSA | 107.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.64 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|