C34H32F2N2O5 — CID 23807440
(4R,5R)-4-benzyl-N-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23807440) has the molecular formula C34H32F2N2O5 and a molecular weight of 586.63 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-N-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-N-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23807440 |
| Molecular Formula | C34H32F2N2O5 |
| Molecular Weight | 586.63 g/mol |
| Exact Mass | 586.23 |
| IUPAC Name | (4R,5R)-4-benzyl-N-[(3,4-difluorophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(Cc2ccccc2)C(=O)NCc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C34H32F2N2O5/c1-41-28-10-5-9-26(20-28)31-34(21-23-7-3-2-4-8-23,33(40)37-22-24-11-16-29(35)30(36)19-24)38-32(43-31)25-12-14-27(15-13-25)42-18-6-17-39/h2-5,7-16,19-20,31,39H,6,17-18,21-22H2,1H3,(H,37,40)/t31-,34-/m1/s1 |
| InChIKey | BEUYJKWVUULYMI-QIKUIUABSA-N |
| XLogP | 5.55 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.63 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|