C28H29BrN2O6 — CID 23947264
(4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-methoxy-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23947264) has the molecular formula C28H29BrN2O6 and a molecular weight of 569.45 g/mol. Its IUPAC name is (4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-methoxy-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-methoxy-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23947264 |
| Molecular Formula | C28H29BrN2O6 |
| Molecular Weight | 569.45 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | (4S,5S)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-methoxy-5-(3-methoxyphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | CONC(=O)[C@@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C28H29BrN2O6/c1-34-24-6-3-5-21(17-24)25-28(27(33)31-35-2,18-19-7-11-22(29)12-8-19)30-26(37-25)20-9-13-23(14-10-20)36-16-4-15-32/h3,5-14,17,25,32H,4,15-16,18H2,1-2H3,(H,31,33)/t25-,28-/m0/s1 |
| InChIKey | RFROMBFVVBINRR-LSYYVWMOSA-N |
| XLogP | 4.40 |
| TPSA | 98.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.45 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|