C28H37N3O5 — CID 23778063
(4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-pentyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23778063) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-pentyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-pentyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23778063 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | (4S,5S)-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N'-pentyl-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C=CC[C@]1(C(=O)NNCCCCC)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1cccc(OC)c1 |
| InChI | InChI=1S/C28H37N3O5/c1-4-6-7-17-29-31-27(33)28(16-5-2)25(22-10-8-11-24(20-22)34-3)36-26(30-28)21-12-14-23(15-13-21)35-19-9-18-32/h5,8,10-15,20,25,29,32H,2,4,6-7,9,16-19H2,1,3H3,(H,31,33)/t25-,28-/m0/s1 |
| InChIKey | PLVJFXFXGFBFBP-LSYYVWMOSA-N |
| XLogP | 4.10 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|