C27H33N3O4 — CID 23777834
(4S,5S)-N'-(cyclopropylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23777834) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is (4S,5S)-N'-(cyclopropylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-(cyclopropylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23777834 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | (4S,5S)-N'-(cyclopropylmethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(C/C=C/c1ccccc1)C(=O)NNCC1CC1 |
| InChI | InChI=1S/C27H33N3O4/c1-20-27(26(32)30-28-19-22-10-11-22,16-5-9-21-7-3-2-4-8-21)29-25(34-20)23-12-14-24(15-13-23)33-18-6-17-31/h2-5,7-9,12-15,20,22,28,31H,6,10-11,16-19H2,1H3,(H,30,32)/b9-5+/t20-,27-/m0/s1 |
| InChIKey | ORVVRMUHGKXAJZ-CZMIDBARSA-N |
| XLogP | 3.49 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|