C26H29Cl2N3O4 — CID 23748244
(4S,5S)-N'-(cyclopropylmethyl)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23748244) has the molecular formula C26H29Cl2N3O4 and a molecular weight of 518.44 g/mol. Its IUPAC name is (4S,5S)-N'-(cyclopropylmethyl)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-(cyclopropylmethyl)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23748244 |
| Molecular Formula | C26H29Cl2N3O4 |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | (4S,5S)-N'-(cyclopropylmethyl)-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C=CC[C@]1(C(=O)NNCC2CC2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H29Cl2N3O4/c1-2-12-26(25(33)31-29-16-17-4-5-17)23(21-11-8-19(27)15-22(21)28)35-24(30-26)18-6-9-20(10-7-18)34-14-3-13-32/h2,6-11,15,17,23,29,32H,1,3-5,12-14,16H2,(H,31,33)/t23-,26-/m0/s1 |
| InChIKey | QXOWASKIDYQXJQ-OZXSUGGESA-N |
| XLogP | 4.62 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|