C31H33Cl2N3O4 — CID 23948020
(4R,5R)-5-(2,4-dichlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23948020) has the molecular formula C31H33Cl2N3O4 and a molecular weight of 582.53 g/mol. Its IUPAC name is (4R,5R)-5-(2,4-dichlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2,4-dichlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23948020 |
| Molecular Formula | C31H33Cl2N3O4 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 581.18 |
| IUPAC Name | (4R,5R)-5-(2,4-dichlorophenyl)-N-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-prop-2-enyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | C=CC[C@@]1(C(=O)NCc2ccc(N(C)C)cc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C31H33Cl2N3O4/c1-4-16-31(30(38)34-20-21-6-11-24(12-7-21)36(2)3)28(26-15-10-23(32)19-27(26)33)40-29(35-31)22-8-13-25(14-9-22)39-18-5-17-37/h4,6-15,19,28,37H,1,5,16-18,20H2,2-3H3,(H,34,38)/t28-,31-/m1/s1 |
| InChIKey | URAPZOGPGPVGTC-GRKNLSHJSA-N |
| XLogP | 5.97 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|