C36H38Cl2N4O6S — CID 23975949
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23975949) has the molecular formula C36H38Cl2N4O6S and a molecular weight of 725.70 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23975949 |
| Molecular Formula | C36H38Cl2N4O6S |
| Molecular Weight | 725.70 g/mol |
| Exact Mass | 724.19 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CN(C)c1ccc(CNNC(=O)[C@@]2(CCS(=O)(=O)c3ccccc3)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C36H38Cl2N4O6S/c1-42(2)28-14-9-25(10-15-28)24-39-41-35(44)36(19-22-49(45,46)30-7-4-3-5-8-30)33(31-18-13-27(37)23-32(31)38)48-34(40-36)26-11-16-29(17-12-26)47-21-6-20-43/h3-5,7-18,23,33,39,43H,6,19-22,24H2,1-2H3,(H,41,44)/t33-,36-/m0/s1 |
| InChIKey | ABOBSIOKJCQQKF-JUKUECOXSA-N |
| XLogP | 5.76 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.70 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|