C29H30Cl2FN3O6S — CID 23749059
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23749059) has the molecular formula C29H30Cl2FN3O6S and a molecular weight of 638.55 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23749059 |
| Molecular Formula | C29H30Cl2FN3O6S |
| Molecular Weight | 638.55 g/mol |
| Exact Mass | 637.12 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-N'-(2-fluoroethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCCF)[C@@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C29H30Cl2FN3O6S/c30-21-9-12-24(25(31)19-21)26-29(28(37)35-33-15-14-32,13-18-42(38,39)23-5-2-1-3-6-23)34-27(41-26)20-7-10-22(11-8-20)40-17-4-16-36/h1-3,5-12,19,26,33,36H,4,13-18H2,(H,35,37)/t26-,29-/m0/s1 |
| InChIKey | SMQXWHKGWZRZJT-WNJJXGMVSA-N |
| XLogP | 4.47 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.55 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|