C37H38Cl2N2O9S — CID 23749145
(4R,5R)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23749145) has the molecular formula C37H38Cl2N2O9S and a molecular weight of 757.69 g/mol. Its IUPAC name is (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23749145 |
| Molecular Formula | C37H38Cl2N2O9S |
| Molecular Weight | 757.69 g/mol |
| Exact Mass | 756.17 |
| IUPAC Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N-[(3,4,5-trimethoxyphenyl)methyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cc(CNC(=O)[C@]2(CCS(=O)(=O)c3ccccc3)N=C(c3ccc(OCCCO)cc3)O[C@@H]2c2ccc(Cl)cc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C37H38Cl2N2O9S/c1-46-31-20-24(21-32(47-2)33(31)48-3)23-40-36(43)37(16-19-51(44,45)28-8-5-4-6-9-28)34(29-15-12-26(38)22-30(29)39)50-35(41-37)25-10-13-27(14-11-25)49-18-7-17-42/h4-6,8-15,20-22,34,42H,7,16-19,23H2,1-3H3,(H,40,43)/t34-,37-/m1/s1 |
| InChIKey | LZZYWIRHJUEXDC-ZLHGTEGGSA-N |
| XLogP | 6.22 |
| TPSA | 141.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.69 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|