C36H40N4O6S — CID 23863322
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23863322) has the molecular formula C36H40N4O6S and a molecular weight of 656.80 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23863322 |
| Molecular Formula | C36H40N4O6S |
| Molecular Weight | 656.80 g/mol |
| Exact Mass | 656.27 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[[4-(dimethylamino)phenyl]methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CN(C)c1ccc(CNNC(=O)[C@@]2(CCS(=O)(=O)c3ccccc3)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C36H40N4O6S/c1-40(2)30-18-14-27(15-19-30)26-37-39-35(42)36(22-25-47(43,44)32-12-7-4-8-13-32)33(28-10-5-3-6-11-28)46-34(38-36)29-16-20-31(21-17-29)45-24-9-23-41/h3-8,10-21,33,37,41H,9,22-26H2,1-2H3,(H,39,42)/t33-,36-/m0/s1 |
| InChIKey | TWMBMJQVXJIPJZ-JUKUECOXSA-N |
| XLogP | 4.46 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.80 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|