C47H44N2O6S — CID 23892176
(4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23892176) has the molecular formula C47H44N2O6S and a molecular weight of 764.94 g/mol. Its IUPAC name is (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23892176 |
| Molecular Formula | C47H44N2O6S |
| Molecular Weight | 764.94 g/mol |
| Exact Mass | 764.29 |
| IUPAC Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(2,2-diphenylethyl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCC(c1ccccc1)c1ccccc1)[C@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C47H44N2O6S/c50-31-13-32-54-41-28-26-40(27-29-41)45-49-47(30-33-56(52,53)42-20-11-4-12-21-42,44(55-45)39-24-22-36(23-25-39)35-14-5-1-6-15-35)46(51)48-34-43(37-16-7-2-8-17-37)38-18-9-3-10-19-38/h1-12,14-29,43-44,50H,13,30-34H2,(H,48,51)/t44-,47-/m1/s1 |
| InChIKey | MWWXKBSILHTXBZ-GVBTYHKLSA-N |
| XLogP | 8.18 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 764.94 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|