C46H40N2O6S — CID 23778399
(4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23778399) has the molecular formula C46H40N2O6S and a molecular weight of 748.90 g/mol. Its IUPAC name is (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23778399 |
| Molecular Formula | C46H40N2O6S |
| Molecular Weight | 748.90 g/mol |
| Exact Mass | 748.26 |
| IUPAC Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-N-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC1c2ccccc2-c2ccccc21)[C@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C46H40N2O6S/c49-29-11-30-53-36-26-24-35(25-27-36)44-48-46(28-31-55(51,52)37-14-5-2-6-15-37,43(54-44)34-22-20-33(21-23-34)32-12-3-1-4-13-32)45(50)47-42-40-18-9-7-16-38(40)39-17-8-10-19-41(39)42/h1-10,12-27,42-43,49H,11,28-31H2,(H,47,50)/t43-,46-/m1/s1 |
| InChIKey | OMMSBSAITOZRHL-ZAONQEHXSA-N |
| XLogP | 8.12 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.90 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|