C27H27BrN2O7S — CID 23748861
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23748861) has the molecular formula C27H27BrN2O7S and a molecular weight of 603.49 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23748861 |
| Molecular Formula | C27H27BrN2O7S |
| Molecular Weight | 603.49 g/mol |
| Exact Mass | 602.07 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-N-hydroxy-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NO)[C@@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C27H27BrN2O7S/c28-23-10-5-4-9-22(23)24-27(26(32)30-33,15-18-38(34,35)21-7-2-1-3-8-21)29-25(37-24)19-11-13-20(14-12-19)36-17-6-16-31/h1-5,7-14,24,31,33H,6,15-18H2,(H,30,32)/t24-,27-/m0/s1 |
| InChIKey | UFIZTEOHIYZUEB-IGKIAQTJSA-N |
| XLogP | 3.84 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|