C40H38BrN3O6S2 — CID 23863971
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(2-phenylsulfanylphenyl)methyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23863971) has the molecular formula C40H38BrN3O6S2 and a molecular weight of 800.80 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(2-phenylsulfanylphenyl)methyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(2-phenylsulfanylphenyl)methyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23863971 |
| Molecular Formula | C40H38BrN3O6S2 |
| Molecular Weight | 800.80 g/mol |
| Exact Mass | 799.14 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-[(2-phenylsulfanylphenyl)methyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCc1ccccc1Sc1ccccc1)[C@@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1Br |
| InChI | InChI=1S/C40H38BrN3O6S2/c41-35-18-9-8-17-34(35)37-40(24-27-52(47,48)33-15-5-2-6-16-33,43-38(50-37)29-20-22-31(23-21-29)49-26-11-25-45)39(46)44-42-28-30-12-7-10-19-36(30)51-32-13-3-1-4-14-32/h1-10,12-23,37,42,45H,11,24-28H2,(H,44,46)/t37-,40-/m0/s1 |
| InChIKey | TZZSVXJRIPMCMG-DFUITMLUSA-N |
| XLogP | 7.30 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 800.80 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|