C27H27N5O6S — CID 23748566
(4R,5R)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23748566) has the molecular formula C27H27N5O6S and a molecular weight of 549.61 g/mol. Its IUPAC name is (4R,5R)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23748566 |
| Molecular Formula | C27H27N5O6S |
| Molecular Weight | 549.61 g/mol |
| Exact Mass | 549.17 |
| IUPAC Name | (4R,5R)-5-(2-azidophenyl)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=Nc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(CCS(=O)(=O)c1ccccc1)C(N)=O |
| InChI | InChI=1S/C27H27N5O6S/c28-26(34)27(15-18-39(35,36)21-7-2-1-3-8-21)24(22-9-4-5-10-23(22)31-32-29)38-25(30-27)19-11-13-20(14-12-19)37-17-6-16-33/h1-5,7-14,24,33H,6,15-18H2,(H2,28,34)/t24-,27-/m1/s1 |
| InChIKey | YDZFUUUYVXXXSL-SHQCIBLASA-N |
| XLogP | 4.00 |
| TPSA | 177.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.61 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|