C38H42N2O6S — CID 23807411
(4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-pentyl-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23807411) has the molecular formula C38H42N2O6S and a molecular weight of 654.83 g/mol. Its IUPAC name is (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-pentyl-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-pentyl-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23807411 |
| Molecular Formula | C38H42N2O6S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N-pentyl-5-(4-phenylphenyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCNC(=O)[C@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C38H42N2O6S/c1-2-3-10-25-39-37(42)38(24-28-47(43,44)34-14-8-5-9-15-34)35(31-18-16-30(17-19-31)29-12-6-4-7-13-29)46-36(40-38)32-20-22-33(23-21-32)45-27-11-26-41/h4-9,12-23,35,41H,2-3,10-11,24-28H2,1H3,(H,39,42)/t35-,38-/m1/s1 |
| InChIKey | OJSUOGBVPISJRP-FOYYQAIFSA-N |
| XLogP | 6.54 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|