C27H36N2O6S — CID 23975333
(4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pentyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 23975333) has the molecular formula C27H36N2O6S and a molecular weight of 516.66 g/mol. Its IUPAC name is (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pentyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pentyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23975333 |
| Molecular Formula | C27H36N2O6S |
| Molecular Weight | 516.66 g/mol |
| Exact Mass | 516.23 |
| IUPAC Name | (4R,5R)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-N-pentyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | CCCCCNC(=O)[C@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1C |
| InChI | InChI=1S/C27H36N2O6S/c1-3-4-8-17-28-26(31)27(16-20-36(32,33)24-10-6-5-7-11-24)21(2)35-25(29-27)22-12-14-23(15-13-22)34-19-9-18-30/h5-7,10-15,21,30H,3-4,8-9,16-20H2,1-2H3,(H,28,31)/t21-,27-/m1/s1 |
| InChIKey | ZVIKQLHENNOWMW-JIPXPUAJSA-N |
| XLogP | 3.52 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.66 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|