C23H29N3O6S — CID 23806898
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N',5-dimethyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806898) has the molecular formula C23H29N3O6S and a molecular weight of 475.57 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N',5-dimethyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N',5-dimethyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806898 |
| Molecular Formula | C23H29N3O6S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-N',5-dimethyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CNNC(=O)[C@@]1(CCS(=O)(=O)c2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1C |
| InChI | InChI=1S/C23H29N3O6S/c1-17-23(22(28)26-24-2,13-16-33(29,30)20-7-4-3-5-8-20)25-21(32-17)18-9-11-19(12-10-18)31-15-6-14-27/h3-5,7-12,17,24,27H,6,13-16H2,1-2H3,(H,26,28)/t17-,23-/m0/s1 |
| InChIKey | QGJQXYOJDPSBQN-SBUREZEXSA-N |
| XLogP | 1.47 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|