C30H34FN3O6S — CID 23835590
(4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23835590) has the molecular formula C30H34FN3O6S and a molecular weight of 583.68 g/mol. Its IUPAC name is (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23835590 |
| Molecular Formula | C30H34FN3O6S |
| Molecular Weight | 583.68 g/mol |
| Exact Mass | 583.22 |
| IUPAC Name | (4S,5S)-4-[2-(benzenesulfonyl)ethyl]-N'-[2-(2-fluorophenyl)ethyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-methyl-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | C[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(CCS(=O)(=O)c1ccccc1)C(=O)NNCCc1ccccc1F |
| InChI | InChI=1S/C30H34FN3O6S/c1-22-30(17-21-41(37,38)26-9-3-2-4-10-26,29(36)34-32-18-16-23-8-5-6-11-27(23)31)33-28(40-22)24-12-14-25(15-13-24)39-20-7-19-35/h2-6,8-15,22,32,35H,7,16-21H2,1H3,(H,34,36)/t22-,30-/m0/s1 |
| InChIKey | QJEWSFTUTOHEGG-CHJDUVSTSA-N |
| XLogP | 3.22 |
| TPSA | 126.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.68 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|