C30H37Cl2N3O6 — CID 23920029
tert-butyl 3-[(4S,5S)-4-[(cyclopropylmethylamino)carbamoyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23920029) has the molecular formula C30H37Cl2N3O6 and a molecular weight of 606.55 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-4-[(cyclopropylmethylamino)carbamoyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-4-[(cyclopropylmethylamino)carbamoyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23920029 |
| Molecular Formula | C30H37Cl2N3O6 |
| Molecular Weight | 606.55 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-4-[(cyclopropylmethylamino)carbamoyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)NNCC2CC2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C30H37Cl2N3O6/c1-29(2,3)41-25(37)13-14-30(28(38)35-33-18-19-5-6-19)26(23-12-9-21(31)17-24(23)32)40-27(34-30)20-7-10-22(11-8-20)39-16-4-15-36/h7-12,17,19,26,33,36H,4-6,13-16,18H2,1-3H3,(H,35,38)/t26-,30-/m0/s1 |
| InChIKey | HFXZWRBHCHEJDM-YZNIXAGQSA-N |
| XLogP | 5.16 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.55 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|