C34H37Cl2F2N3O6 — CID 23778144
tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-4-[[2-(3,5-difluorophenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23778144) has the molecular formula C34H37Cl2F2N3O6 and a molecular weight of 692.59 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-4-[[2-(3,5-difluorophenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-4-[[2-(3,5-difluorophenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23778144 |
| Molecular Formula | C34H37Cl2F2N3O6 |
| Molecular Weight | 692.59 g/mol |
| Exact Mass | 691.20 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-(2,4-dichlorophenyl)-4-[[2-(3,5-difluorophenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)NNCCc2cc(F)cc(F)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C34H37Cl2F2N3O6/c1-33(2,3)47-29(43)11-13-34(32(44)41-39-14-12-21-17-24(37)20-25(38)18-21)30(27-10-7-23(35)19-28(27)36)46-31(40-34)22-5-8-26(9-6-22)45-16-4-15-42/h5-10,17-20,30,39,42H,4,11-16H2,1-3H3,(H,41,44)/t30-,34-/m0/s1 |
| InChIKey | WVZSQEHOAQXRPL-NHZFLZHXSA-N |
| XLogP | 6.28 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|