C34H40FN3O7 — CID 23920066
tert-butyl 3-[(4S,5S)-4-[[(4-fluorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23920066) has the molecular formula C34H40FN3O7 and a molecular weight of 621.71 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-4-[[(4-fluorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-4-[[(4-fluorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23920066 |
| Molecular Formula | C34H40FN3O7 |
| Molecular Weight | 621.71 g/mol |
| Exact Mass | 621.29 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-4-[[(4-fluorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | COc1cccc([C@@H]2OC(c3ccc(OCCCO)cc3)=N[C@]2(CCC(=O)OC(C)(C)C)C(=O)NNCc2ccc(F)cc2)c1 |
| InChI | InChI=1S/C34H40FN3O7/c1-33(2,3)45-29(40)17-18-34(32(41)38-36-22-23-9-13-26(35)14-10-23)30(25-7-5-8-28(21-25)42-4)44-31(37-34)24-11-15-27(16-12-24)43-20-6-19-39/h5,7-16,21,30,36,39H,6,17-20,22H2,1-4H3,(H,38,41)/t30-,34-/m0/s1 |
| InChIKey | SAKYNHMEPRJDKM-NHZFLZHXSA-N |
| XLogP | 4.80 |
| TPSA | 127.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.71 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|