C36H44BrN3O9 — CID 23919858
tert-butyl 3-[(4S,5S)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[(3,4,5-trimethoxyphenyl)methylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23919858) has the molecular formula C36H44BrN3O9 and a molecular weight of 742.66 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[(3,4,5-trimethoxyphenyl)methylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[(3,4,5-trimethoxyphenyl)methylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23919858 |
| Molecular Formula | C36H44BrN3O9 |
| Molecular Weight | 742.66 g/mol |
| Exact Mass | 741.23 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-(2-bromophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-[[(3,4,5-trimethoxyphenyl)methylamino]carbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | COc1cc(CNNC(=O)[C@@]2(CCC(=O)OC(C)(C)C)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccccc2Br)cc(OC)c1OC |
| InChI | InChI=1S/C36H44BrN3O9/c1-35(2,3)49-30(42)16-17-36(34(43)40-38-22-23-20-28(44-4)31(46-6)29(21-23)45-5)32(26-10-7-8-11-27(26)37)48-33(39-36)24-12-14-25(15-13-24)47-19-9-18-41/h7-8,10-15,20-21,32,38,41H,9,16-19,22H2,1-6H3,(H,40,43)/t32-,36-/m0/s1 |
| InChIKey | DSLCWUQNKUNHJN-IKYOIFQTSA-N |
| XLogP | 5.44 |
| TPSA | 146.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.66 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|