C35H36F6N6O6 — CID 23806964
tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-4-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23806964) has the molecular formula C35H36F6N6O6 and a molecular weight of 750.70 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-4-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-4-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23806964 |
| Molecular Formula | C35H36F6N6O6 |
| Molecular Weight | 750.70 g/mol |
| Exact Mass | 750.26 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-4-[[[3,5-bis(trifluoromethyl)phenyl]methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)NNCc2cc(C(F)(F)F)cc(C(F)(F)F)c2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C35H36F6N6O6/c1-32(2,3)53-28(49)13-14-33(31(50)46-43-20-21-17-23(34(36,37)38)19-24(18-21)35(39,40)41)29(26-7-4-5-8-27(26)45-47-42)52-30(44-33)22-9-11-25(12-10-22)51-16-6-15-48/h4-5,7-12,17-19,29,43,48H,6,13-16,20H2,1-3H3,(H,46,50)/t29-,33-/m0/s1 |
| InChIKey | ZEOFNCOBQCNFHJ-ZQAZVOLISA-N |
| XLogP | 7.63 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.70 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|