C30H37N5O6 — CID 23777400
tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-4-(cyclopropylmethylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23777400) has the molecular formula C30H37N5O6 and a molecular weight of 563.66 g/mol. Its IUPAC name is tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-4-(cyclopropylmethylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-4-(cyclopropylmethylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23777400 |
| Molecular Formula | C30H37N5O6 |
| Molecular Weight | 563.66 g/mol |
| Exact Mass | 563.27 |
| IUPAC Name | tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-4-(cyclopropylmethylcarbamoyl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@]1(C(=O)NCC2CC2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C30H37N5O6/c1-29(2,3)41-25(37)15-16-30(28(38)32-19-20-9-10-20)26(23-7-4-5-8-24(23)34-35-31)40-27(33-30)21-11-13-22(14-12-21)39-18-6-17-36/h4-5,7-8,11-14,20,26,36H,6,9-10,15-19H2,1-3H3,(H,32,38)/t26-,30-/m1/s1 |
| InChIKey | RERKBEOJNVDSSU-PDDLMNHVSA-N |
| XLogP | 5.29 |
| TPSA | 155.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.66 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|