C35H41N5O7 — CID 23836006
tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(2-methoxyphenyl)methylcarbamoyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23836006) has the molecular formula C35H41N5O7 and a molecular weight of 643.74 g/mol. Its IUPAC name is tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(2-methoxyphenyl)methylcarbamoyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(2-methoxyphenyl)methylcarbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23836006 |
| Molecular Formula | C35H41N5O7 |
| Molecular Weight | 643.74 g/mol |
| Exact Mass | 643.30 |
| IUPAC Name | tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(2-methoxyphenyl)methylcarbamoyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | COc1ccccc1CNC(=O)[C@]1(CCC(=O)OC(C)(C)C)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C35H41N5O7/c1-34(2,3)47-30(42)18-19-35(33(43)37-22-26-11-6-8-13-29(26)44-4)31(28-12-7-5-10-25(28)23-38-40-36)46-32(39-35)24-14-16-27(17-15-24)45-21-9-20-41/h5-8,10-17,31,41H,9,18-23H2,1-4H3,(H,37,43)/t31-,35-/m1/s1 |
| InChIKey | IHWPTYIAPDLRSW-CYEXUTLASA-N |
| XLogP | 5.96 |
| TPSA | 164.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.74 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|