C27H32N4O7 — CID 23975574
(4S,5S)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5H-1,3-oxazole-4-carboxylic acid (PubChem CID 23975574) has the molecular formula C27H32N4O7 and a molecular weight of 524.57 g/mol. Its IUPAC name is (4S,5S)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5H-1,3-oxazole-4-carboxylic acid.
| Compound Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5H-1,3-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 23975574 |
| Molecular Formula | C27H32N4O7 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropyl]-5H-1,3-oxazole-4-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)O)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C27H32N4O7/c1-26(2,3)38-22(33)13-14-27(25(34)35)23(21-8-5-4-7-19(21)17-29-31-28)37-24(30-27)18-9-11-20(12-10-18)36-16-6-15-32/h4-5,7-12,23,32H,6,13-17H2,1-3H3,(H,34,35)/t23-,27-/m0/s1 |
| InChIKey | KNJCTWVPSJIVSO-HOFKKMOUSA-N |
| XLogP | 4.72 |
| TPSA | 163.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|