C37H46N6O8 — CID 23748158
tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(2,5-dimethoxyphenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23748158) has the molecular formula C37H46N6O8 and a molecular weight of 702.81 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(2,5-dimethoxyphenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(2,5-dimethoxyphenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23748158 |
| Molecular Formula | C37H46N6O8 |
| Molecular Weight | 702.81 g/mol |
| Exact Mass | 702.34 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[2-(2,5-dimethoxyphenyl)ethylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | COc1ccc(OC)c(CCNNC(=O)[C@@]2(CCC(=O)OC(C)(C)C)N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccccc2CN=[N+]=[N-])c1 |
| InChI | InChI=1S/C37H46N6O8/c1-36(2,3)51-32(45)17-19-37(35(46)42-39-20-18-26-23-29(47-4)15-16-31(26)48-5)33(30-10-7-6-9-27(30)24-40-43-38)50-34(41-37)25-11-13-28(14-12-25)49-22-8-21-44/h6-7,9-16,23,33,39,44H,8,17-22,24H2,1-5H3,(H,42,46)/t33-,37-/m0/s1 |
| InChIKey | BVFKYUGFPPUNSC-WNOXWKSXSA-N |
| XLogP | 5.52 |
| TPSA | 185.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.81 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|