C34H39ClN6O6 — CID 23891823
tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[(2-chlorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23891823) has the molecular formula C34H39ClN6O6 and a molecular weight of 663.18 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[(2-chlorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[(2-chlorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23891823 |
| Molecular Formula | C34H39ClN6O6 |
| Molecular Weight | 663.18 g/mol |
| Exact Mass | 662.26 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[[(2-chlorophenyl)methylamino]carbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@]1(C(=O)NNCc2ccccc2Cl)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C34H39ClN6O6/c1-33(2,3)47-29(43)17-18-34(32(44)40-37-22-25-10-5-7-12-28(25)35)30(27-11-6-4-9-24(27)21-38-41-36)46-31(39-34)23-13-15-26(16-14-23)45-20-8-19-42/h4-7,9-16,30,37,42H,8,17-22H2,1-3H3,(H,40,44)/t30-,34-/m0/s1 |
| InChIKey | DCRDAYUJUKJHTC-NHZFLZHXSA-N |
| XLogP | 6.11 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.18 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|