C27H34N6O6 — CID 23748136
tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(methylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23748136) has the molecular formula C27H34N6O6 and a molecular weight of 538.61 g/mol. Its IUPAC name is tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(methylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(methylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23748136 |
| Molecular Formula | C27H34N6O6 |
| Molecular Weight | 538.61 g/mol |
| Exact Mass | 538.25 |
| IUPAC Name | tert-butyl 3-[(4S,5S)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(methylaminocarbamoyl)-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CNNC(=O)[C@@]1(CCC(=O)OC(C)(C)C)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C27H34N6O6/c1-26(2,3)39-22(35)14-15-27(25(36)32-29-4)23(20-8-5-6-9-21(20)31-33-28)38-24(30-27)18-10-12-19(13-11-18)37-17-7-16-34/h5-6,8-13,23,29,34H,7,14-17H2,1-4H3,(H,32,36)/t23-,27-/m0/s1 |
| InChIKey | WKMCLEYAWSUNNJ-HOFKKMOUSA-N |
| XLogP | 4.02 |
| TPSA | 167.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.61 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|