C31H41N5O6 — CID 23920102
tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(pentylcarbamoyl)-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23920102) has the molecular formula C31H41N5O6 and a molecular weight of 579.70 g/mol. Its IUPAC name is tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(pentylcarbamoyl)-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(pentylcarbamoyl)-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23920102 |
| Molecular Formula | C31H41N5O6 |
| Molecular Weight | 579.70 g/mol |
| Exact Mass | 579.31 |
| IUPAC Name | tert-butyl 3-[(4R,5R)-5-(2-azidophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-4-(pentylcarbamoyl)-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CCCCCNC(=O)[C@]1(CCC(=O)OC(C)(C)C)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1N=[N+]=[N-] |
| InChI | InChI=1S/C31H41N5O6/c1-5-6-9-19-33-29(39)31(18-17-26(38)42-30(2,3)4)27(24-11-7-8-12-25(24)35-36-32)41-28(34-31)22-13-15-23(16-14-22)40-21-10-20-37/h7-8,11-16,27,37H,5-6,9-10,17-21H2,1-4H3,(H,33,39)/t27-,31-/m1/s1 |
| InChIKey | KBAKDLPNXWSASL-DLFZDVPBSA-N |
| XLogP | 6.07 |
| TPSA | 155.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.70 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|