C34H37Cl2N5O6 — CID 23864339
tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-4-[(3,4-dichlorophenyl)methylcarbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate (PubChem CID 23864339) has the molecular formula C34H37Cl2N5O6 and a molecular weight of 682.61 g/mol. Its IUPAC name is tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-4-[(3,4-dichlorophenyl)methylcarbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate.
| Compound Name | tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-4-[(3,4-dichlorophenyl)methylcarbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
|---|---|
| PubChem CID | 23864339 |
| Molecular Formula | C34H37Cl2N5O6 |
| Molecular Weight | 682.61 g/mol |
| Exact Mass | 681.21 |
| IUPAC Name | tert-butyl 3-[(4R,5R)-5-[2-(azidomethyl)phenyl]-4-[(3,4-dichlorophenyl)methylcarbamoyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazol-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CC[C@@]1(C(=O)NCc2ccc(Cl)c(Cl)c2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1CN=[N+]=[N-] |
| InChI | InChI=1S/C34H37Cl2N5O6/c1-33(2,3)47-29(43)15-16-34(32(44)38-20-22-9-14-27(35)28(36)19-22)30(26-8-5-4-7-24(26)21-39-41-37)46-31(40-34)23-10-12-25(13-11-23)45-18-6-17-42/h4-5,7-14,19,30,42H,6,15-18,20-21H2,1-3H3,(H,38,44)/t30-,34-/m1/s1 |
| InChIKey | XMZAVQCNHVIUPK-KAODMTDESA-N |
| XLogP | 7.26 |
| TPSA | 155.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.61 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|